WAY-312602 structure
|
Common Name | WAY-312602 | ||
|---|---|---|---|---|
| CAS Number | 681266-13-7 | Molecular Weight | 339.34858 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 700.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H17N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.3±32.9 °C | |
Use of WAY-312602maternal embryonic leucine zipper kinase inhibitors |
| Name | WAY-312602 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 700.2±60.0 °C at 760 mmHg |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.34858 |
| Flash Point | 377.3±32.9 °C |
| Exact Mass | 367.099060 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | QIAPILCHBKVUKT-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)Nc1c2c(nn1-c1ccccc1)CS(=O)(=O)C2 |
| Benzeneacetamide, N-(2,6-dihydro-5,5-dioxido-2-phenyl-4H-thieno[3,4-c]pyrazol-3-yl)- |
| N-(5,5-Dioxido-2-phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl)-2-phenylacetamide |