Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(methyl) ketone O-(2-hydroxypropyl)oxime structure
|
Common Name | Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(methyl) ketone O-(2-hydroxypropyl)oxime | ||
|---|---|---|---|---|
| CAS Number | 6813-92-9 | Molecular Weight | 219.28000 | |
| Density | 1.144g/cm3 | Boiling Point | 354.663ºC at 760 mmHg | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.295ºC | |
| Name | 1-[(E)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)ethylideneamino]oxypropan-2-ol |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 354.663ºC at 760 mmHg |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28000 |
| Flash Point | 168.295ºC |
| Exact Mass | 219.12600 |
| PSA | 41.82000 |
| LogP | 2.09960 |
| Index of Refraction | 1.564 |
| InChIKey | VKFNGVQUSMHREJ-GXDHUFHOSA-N |
| SMILES | CC(=NOCC(C)O)C1Cc2ccccc21 |
| HS Code | 2928000090 |
|---|
|
~%
Bicyclo[4.2.0]o... CAS#:6813-92-9 |
| Literature: Skorcz; Suh; Judd Journal of medicinal chemistry, 1966 , vol. 9, # 5 p. 656 - 659 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |