1-(4-Trifluoromethyl-phenyl)-piperidin-4-ol structure
|
Common Name | 1-(4-Trifluoromethyl-phenyl)-piperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 681508-70-3 | Molecular Weight | 245.24100 | |
| Density | 1.275g/cm3 | Boiling Point | 334.3ºC at 760 mmHg | |
| Molecular Formula | C12H14F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156ºC | |
| Name | 1-[4-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 334.3ºC at 760 mmHg |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24100 |
| Flash Point | 156ºC |
| Exact Mass | 245.10300 |
| PSA | 23.47000 |
| LogP | 2.73150 |
| Index of Refraction | 1.511 |
| InChIKey | KKEZLXOOIIFZGD-UHFFFAOYSA-N |
| SMILES | OC1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~60%
1-(4-Trifluorom... CAS#:681508-70-3 |
| Literature: SHIONOGI and CO., LTD. Patent: EP1988077 A1, 2008 ; Location in patent: Page/Page column 63-64 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| RW2374 |
| 4-Hydroxy(4-trifluoromethylphenyl)piperidine |
| 1-(4-(trifluoromethyl)phenyl)piperidin-4-ol |