Decanedioic acid dipentyl ester structure
|
Common Name | Decanedioic acid dipentyl ester | ||
|---|---|---|---|---|
| CAS Number | 6819-09-6 | Molecular Weight | 342.51300 | |
| Density | 0.936g/cm3 | Boiling Point | 375.2ºC at 760 mmHg | |
| Molecular Formula | C20H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.2ºC | |
| Name | dipentyl decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.936g/cm3 |
|---|---|
| Boiling Point | 375.2ºC at 760 mmHg |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.51300 |
| Flash Point | 168.2ºC |
| Exact Mass | 342.27700 |
| PSA | 52.60000 |
| LogP | 5.57400 |
| Index of Refraction | 1.449 |
| InChIKey | WZURZWRVLHOHAS-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)CCCCCCCCC(=O)OCCCCC |
|
~%
Decanedioic aci... CAS#:6819-09-6 |
| Literature: Stahl; Pessen Journal of the American Chemical Society, 1952 , vol. 74, p. 5487,5488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Decanedioic acid,dipentyl ester |
| Dipentylsebacat |
| dipentyl sebacate |
| Sebacinsaeurediamylester |
| Decandisaeure-dipentylester |
| Diamylsebacat |
| diamyl sebacate |
| EINECS 229-893-7 |