1,1,1,2,3,3,3-heptachloro-2-(trichloromethyl)propane structure
|
Common Name | 1,1,1,2,3,3,3-heptachloro-2-(trichloromethyl)propane | ||
|---|---|---|---|---|
| CAS Number | 6820-74-2 | Molecular Weight | 402.57300 | |
| Density | 1.929g/cm3 | Boiling Point | 343ºC at 760 mmHg | |
| Molecular Formula | C4Cl10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2ºC | |
| Name | 1,1,1,2,3,3,3-heptachloro-2-(trichloromethyl)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.929g/cm3 |
|---|---|
| Boiling Point | 343ºC at 760 mmHg |
| Molecular Formula | C4Cl10 |
| Molecular Weight | 402.57300 |
| Flash Point | 158.2ºC |
| Exact Mass | 397.68900 |
| LogP | 6.07460 |
| Index of Refraction | 1.575 |
| InChIKey | VYHNGJZGIOYPER-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C(Cl)(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
|
~%
1,1,1,2,3,3,3-h... CAS#:6820-74-2 |
| Literature: Roedig Justus Liebigs Annalen der Chemie, 1951 , vol. 574, p. 122,128 |
|
~%
Detail
|
| Literature: Miller Journal of the American Chemical Society, 1940 , vol. 62, p. 342 |
|
~%
1,1,1,2,3,3,3-h... CAS#:6820-74-2
Detail
|
| Literature: Rasuwaew; Osanowa Zhurnal Obshchei Khimii, 1954 , vol. 24, p. 1771,1774;engl.Ausg.S.1741,1742 |
|
~%
Detail
|
| Literature: Roedig Justus Liebigs Annalen der Chemie, 1951 , vol. 574, p. 122,128 |
|
~%
1,1,1,2,3,3,3-h... CAS#:6820-74-2 |
| Literature: Miller Journal of the American Chemical Society, 1940 , vol. 62, p. 342 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| Decachlor-butan |
| Decachlorobutan |
| decachlorobutane |
| Perchlorbutan |
| PERCHLOROISOBUTANE |
| 1,1,1,2,2,3,3,4,4,4-Decachlor-butan |
| n-Decachlorbutan |