10H-phenothiazine-3-carboxylic acid structure
|
Common Name | 10H-phenothiazine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 68230-59-1 | Molecular Weight | 243.28100 | |
| Density | 1.397g/cm3 | Boiling Point | 484.2ºC at 760 mmHg | |
| Molecular Formula | C13H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.6ºC | |
| Name | Phenothiazine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 484.2ºC at 760 mmHg |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.28100 |
| Flash Point | 246.6ºC |
| Exact Mass | 243.03500 |
| PSA | 74.63000 |
| LogP | 3.73100 |
| Index of Refraction | 1.704 |
| InChIKey | ZAZBAXPDYNCBBL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)Sc1ccccc1N2 |
| Hazard Codes | Xi |
|---|
|
~78%
10H-phenothiazi... CAS#:68230-59-1 |
| Literature: Dai, Chuan; Sun, Xiaofei; Tu, Xingzhao; Wu, Li; Zhan, Dan; Zeng, Qingle Chemical Communications, 2012 , vol. 48, # 43 p. 5367 - 5369 |
|
~%
10H-phenothiazi... CAS#:68230-59-1 |
| Literature: Harfenist, Morton; Joseph, Diane M.; Spence, Sharon C.; Mcgee, Daniel P. C.; Reeves, Mark D.; White, Helen L. Journal of Medicinal Chemistry, 1997 , vol. 40, # 16 p. 2466 - 2473 |
| 3-Cyanophenothiazine |
| 10h-3-phenothiazinecarbonitrile |
| Phenothiazine-3-carbonitrile |
| 10H-phenothiazine-3-carboxylic acid |
| 2-Cyanophenothiazine |