6,8-diprenylnaringenin structure
|
Common Name | 6,8-diprenylnaringenin | ||
|---|---|---|---|---|
| CAS Number | 68236-11-3 | Molecular Weight | 408.48700 | |
| Density | 1.22g/cm3 | Boiling Point | 639.245°C at 760 mmHg | |
| Molecular Formula | C25H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.297°C | |
Use of 6,8-diprenylnaringenin6,8-Diprenylnaringenin (Lonchocarpol A; Senegalensin), a hop prenylflavonoid, is a inhibitor of breast cancer resistance protein (BCRP/ABCG2). 6,8-Diprenylnaringenin inhibits ABCG2-mediated efflux of Mitoxantrone, and 3H-Methotrexate transport (IC50=0.41 μM) in HEK293 cells. 6,8-Diprenylnaringenin exhibits some estrogenicity, but its potency is less than 1% of that of 8-Prenylnaringenin[1][2]. |
| Name | 6,8-diprenylnaringenin |
|---|---|
| Synonym | More Synonyms |
| Description | 6,8-Diprenylnaringenin (Lonchocarpol A; Senegalensin), a hop prenylflavonoid, is a inhibitor of breast cancer resistance protein (BCRP/ABCG2). 6,8-Diprenylnaringenin inhibits ABCG2-mediated efflux of Mitoxantrone, and 3H-Methotrexate transport (IC50=0.41 μM) in HEK293 cells. 6,8-Diprenylnaringenin exhibits some estrogenicity, but its potency is less than 1% of that of 8-Prenylnaringenin[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 639.245°C at 760 mmHg |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.48700 |
| Flash Point | 218.297°C |
| Exact Mass | 408.19400 |
| PSA | 86.99000 |
| LogP | 5.52730 |
| InChIKey | HCNLDGTUMBOHKT-NRFANRHFSA-N |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)C(=O)CC(c1ccc(O)cc1)O2 |
| Senegalensien |
| Lonchocarpol A |
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| Senegalensein |
| Senegalensin |
| 4H-1-Benzopyran-4-one,2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis(3-methyl-2-butenyl)-,(S) |
| 6,8-Diprenylnaringenin |