ethyl 1-tert-butyl-1H-pyrazole-3-carboxylate structure
|
Common Name | ethyl 1-tert-butyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 682757-49-9 | Molecular Weight | 196.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-tert-butylpyrazole-3-carboxylate |
|---|
| Molecular Formula | C10H16N2O2 |
|---|---|
| Molecular Weight | 196.24600 |
| Exact Mass | 196.12100 |
| PSA | 44.12000 |
| LogP | 1.81480 |
| InChIKey | TYTZOSYBGNRPPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccn(C(C)(C)C)n1 |
| HS Code | 2933199090 |
|---|
|
~74%
ethyl 1-tert-bu... CAS#:682757-49-9 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2007/71963 A2, 2007 ; Location in patent: Page/Page column 58 ; WO 2007/071963 A2 |
|
~%
ethyl 1-tert-bu... CAS#:682757-49-9 |
| Literature: E.I. DU PONT DE NEMOURS AND COMPANY Patent: WO2004/35545 A2, 2004 ; Location in patent: Page 41 ; |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |