ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate
ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate structure
|
Common Name | ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 68281-49-2 | Molecular Weight | 275.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate, also known as 乙烯基6-三氟甲基-3,4-二氢-2H-1,4-苯并恶嗪-2-甲酸酯, CAS 68281-49-2, molecular formula C12H12F3NO3, molecular weight 275.22400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F3NO3 |
|---|---|
| Molecular Weight | 275.22400 |
| Exact Mass | 275.07700 |
| PSA | 47.56000 |
| LogP | 2.57940 |
| InChIKey | BNGNTYNJFMUATE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNc2cc(C(F)(F)F)ccc2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 6-trifluoromethyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular formula of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is C12H12F3NO3. |
| Q: What is the polar surface area (PSA) of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 47.56000. |
| Q: What is the molecular weight of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular weight of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 275.22400. |
| Q: What English synonyms does ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate have? |
| A: English synonyms of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate: ethyl 6-trifluoromethyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate. |
| Q: What is the CAS number of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: CAS number of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 68281-49-2. |
| Q: What is the InChIKey of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: InChIKey of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is BNGNTYNJFMUATE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 68281-49-2? |
| A: Chinese name of 68281-49-2 is 68281-49-2. |
| Q: What is the SMILES notation of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: SMILES notation of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is CCOC(=O)C1CNc2cc(C(F)(F)F)ccc2O1. |
| Q: What is the English name of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: The English name of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate. |
| Q: What is the LogP of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: LogP of ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 2.57940. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |