2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene structure
|
Common Name | 2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 68400-47-5 | Molecular Weight | 333.40200 | |
| Density | 1.24 g/cm3 | Boiling Point | 500ºC at 760 mmHg | |
| Molecular Formula | C17H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-Diethoxy-4-nitrophenyl)(p-tolyl)sulfane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760 mmHg |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.40200 |
| Exact Mass | 333.10300 |
| PSA | 89.58000 |
| LogP | 5.37500 |
| Index of Refraction | 1.601 |
| InChIKey | JRKVBFFPQZNRRC-UHFFFAOYSA-N |
| SMILES | CCOc1cc([N+](=O)[O-])c(OCC)cc1Sc1ccc(C)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
2,5-Diethoxy-4-... CAS#:68400-47-5 |
| Literature: Kalle and Co. Patent: DE896591 , 1951 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Diethoxy-4-((4-methylphenyl)thio)nitrobenzene |