1-chloro-2,5-diethoxy-4-nitrobenzene structure
|
Common Name | 1-chloro-2,5-diethoxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 91-43-0 | Molecular Weight | 245.66000 | |
| Density | 1.264 g/cm3 | Boiling Point | 368.4ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-2,5-diethoxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264 g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66000 |
| Exact Mass | 245.04500 |
| PSA | 64.28000 |
| LogP | 3.56880 |
| Index of Refraction | 1.533 |
| InChIKey | HWLDAZMGMQYWGW-UHFFFAOYSA-N |
| SMILES | CCOc1cc([N+](=O)[O-])c(OCC)cc1Cl |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2909309090 |
|
~78%
1-chloro-2,5-di... CAS#:91-43-0 |
| Literature: Weitman, Michal; Lerman, Keti; Nudelman, Abraham; Major, Dan Thomas; Hizi, Amnon; Herschhorn, Alon European Journal of Medicinal Chemistry, 2011 , vol. 46, # 2 p. 447 - 467 |
|
~%
1-chloro-2,5-di... CAS#:91-43-0 |
| Literature: European Journal of Medicinal Chemistry, , vol. 46, # 2 p. 447 - 467 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 202-067-3 |
| 5-Chloro-2-nitro-p-diethoxybenzene |
| Benzene,1-chloro-2,5-diethoxy-4-nitro |
| Benzene,5-diethoxy-4-nitro |
| MFCD00024578 |
| 2,5-Diethoxy-4-nitrochlorobenzene |
| 1,4-diethoxy-2-chloro-5-nitro-benzene |
| 1,4-Diaethoxy-2-chlor-5-nitro-benzol |