1-Chloro-3-(4-chlorophenoxy)benzene structure
|
Common Name | 1-Chloro-3-(4-chlorophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 6842-62-2 | Molecular Weight | 239.097 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 314.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.8±21.7 °C | |
| Name | 3,4'-Dichlorodiphenyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.9±22.0 °C at 760 mmHg |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.097 |
| Flash Point | 109.8±21.7 °C |
| Exact Mass | 237.995224 |
| PSA | 9.23000 |
| LogP | 5.52 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Oc2cccc(Cl)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
|
~%
1-Chloro-3-(4-c... CAS#:6842-62-2 |
| Literature: US4766253 A1, ; |
|
~89%
1-Chloro-3-(4-c... CAS#:6842-62-2 |
| Literature: Environmental Science & Technology, , vol. 28, # 7 p. 1341 - 1347 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Chlorophenyl 4-chlorophenyl ether |
| GR COR DG |
| 1-Chloro-3-(4-chlorophenoxy)benzene |
| 3,4'-Dichlorodiphenyl ether |
| MFCD00043876 |