Quinoline, 6-methyl-8-nitro structure
|
Common Name | Quinoline, 6-methyl-8-nitro | ||
|---|---|---|---|---|
| CAS Number | 68420-92-8 | Molecular Weight | 188.18300 | |
| Density | 1.298g/cm3 | Boiling Point | 344.6ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | 6-Methyl-8-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760 mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 162.2ºC |
| Exact Mass | 188.05900 |
| PSA | 58.71000 |
| LogP | 2.97460 |
| Index of Refraction | 1.661 |
| InChIKey | APXIIWAJZKHFIV-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c2ncccc2c1 |
| HS Code | 2933499090 |
|---|
|
~66%
Quinoline, 6-me... CAS#:68420-92-8 |
| Literature: NOSCIRA, S.A.; MEDINA PADILLA, Miguel; CASTRO MORERA, Ana; SANCHEZ-QUESADA, Jorge; GARCIA PALOMERO, Esther Patent: WO2010/66832 A1, 2010 ; Location in patent: Page/Page column 38-39 ; |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-8-nitro-quinoline |
| Quinoline,6-methyl-8-nitro |
| 6-Methyl-8-nitro-chinolin |