1-Amino-2-nitro-4-methylbenzene structure
|
Common Name | 1-Amino-2-nitro-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 89-62-3 | Molecular Weight | 152.151 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 302.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O2 | Melting Point | 115-116 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 137.0±22.3 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 2-nitro-p-toluidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.9±22.0 °C at 760 mmHg |
| Melting Point | 115-116 °C(lit.) |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.151 |
| Flash Point | 137.0±22.3 °C |
| Exact Mass | 152.058578 |
| PSA | 71.84000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | DLURHXYXQYMPLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c([N+](=O)[O-])c1 |
| Storage condition | −20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H331-H373-H411 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R23/24/25;R33;R51/53 |
| Safety Phrases | S28-S36/37-S45-S61 |
| RIDADR | UN 2660 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XU8227250 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29214300 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Primary Screen Inhibitors of CD40 Signaling in BL2 Cells Measured in Cell-Based Syste...
Source: Broad Institute
Target: N/A
External Id: 7124-01_Inhibitor_SinglePoint_HTS_Activity
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
| MNPT |
| p-Me,o-NO2-aniline |
| ZR D1 BNW |
| 1-Amino-4-methyl-2-nitrobenzene |
| 2-Nitro-p-toluidine |
| 4-methyl-2-nitrophenylamine |
| MFCD00057926 |
| Fast Red GL |
| 4-Methyl-2-nitrobenzenamine |
| 3-Nitro-4-toluidine |
| 1-amino-2-nitro-4-methylbenzene |
| 4-Methyl-2-nitroaniline |
| 3-nitro-4-amino-toluene |
| 4-Amino-3-nitrotoluene |
| 2-nitro-4-methyl-aniline |
| o-nitro-p-methylaniline |
| EINECS 201-924-9 |
| Fast Red GL Base |
| p-Toluidine,2-nitro |