3,9,15-trioxa-6,12-dithia-21-azabicyclo[15.3.1]henicosa-18,20,22-triene-2,16-dione structure
|
Common Name | 3,9,15-trioxa-6,12-dithia-21-azabicyclo[15.3.1]henicosa-18,20,22-triene-2,16-dione | ||
|---|---|---|---|---|
| CAS Number | 68436-51-1 | Molecular Weight | 357.44500 | |
| Density | 1.233g/cm3 | Boiling Point | 661.4ºC at 760 mmHg | |
| Molecular Formula | C15H19NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353.8ºC | |
| Name | 3,9,15-trioxa-6,12-dithia-21-azabicyclo[15.3.1]henicosa-1(21),17,19-triene-2,16-dione |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 661.4ºC at 760 mmHg |
| Molecular Formula | C15H19NO5S2 |
| Molecular Weight | 357.44500 |
| Flash Point | 353.8ºC |
| Exact Mass | 357.07000 |
| PSA | 125.32000 |
| LogP | 1.89180 |
| Index of Refraction | 1.535 |
| InChIKey | LRISKFCJYKCVKX-UHFFFAOYSA-N |
| SMILES | O=C1OCCSCCOCCSCCOC(=O)c2cccc1n2 |
|
~%
3,9,15-trioxa-6... CAS#:68436-51-1 |
| Literature: Bradshaw,J.S. et al. Journal of Heterocyclic Chemistry, 1978 , vol. 15, p. 825 - 831 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |