allyl(4-methoxyphenyl)dimethylsilane
allyl(4-methoxyphenyl)dimethylsilane structure
|
Common Name | allyl(4-methoxyphenyl)dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 68469-60-3 | Molecular Weight | 206.35600 | |
| Density | 0.935 g/mL at 25ºC(lit.) | Boiling Point | 253ºC(lit.) | |
| Molecular Formula | C12H18OSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 215 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-methoxyphenyl)-dimethyl-prop-2-enylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.935 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 253ºC(lit.) |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.35600 |
| Flash Point | 215 °F |
| Exact Mass | 206.11300 |
| PSA | 9.23000 |
| LogP | 2.79660 |
| Index of Refraction | n20/D 1.519(lit.) |
| InChIKey | BEKRXBQZYQZFBV-UHFFFAOYSA-N |
| SMILES | C=CC[Si](C)(C)c1ccc(OC)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
allyl(4-methoxy... CAS#:68469-60-3 |
| Literature: Journal of the American Chemical Society, , vol. 100, p. 5534 - 5540 |
|
~%
allyl(4-methoxy... CAS#:68469-60-3 |
| Literature: Journal of Organic Chemistry, , vol. 62, # 18 p. 6102 - 6103 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 2 | |
CAS#:1373139-29-7
CAS#:877-68-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD01862880 |
| Allyl(4-methoxyphenyl)dimethylsilane |
| Allyldimethyl(4-methoxyphenyl)silane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: InChIKey of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is BEKRXBQZYQZFBV-UHFFFAOYSA-N. |
| Q: What is the CAS number of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: CAS number of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is 68469-60-3. |
| Q: What is the molecular weight of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Molecular weight of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is 206.35600. |
| Q: What are the downstream products of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Related downstream products(CAS) of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane: 1373139-29-7;877-68-9. |
| Q: What is the boiling point of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Boiling point of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is 253ºC(lit.). |
| Q: What is the LogP of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: LogP of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is 2.79660. |
| Q: What is the molecular formula of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Molecular formula of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is C12H18OSi. |
| Q: What are the upstream materials of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Related upstream materials(CAS) of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane: 2372-33-0;2622-05-1;104-92-7;4028-23-3. |
| Q: What is the polar surface area (PSA) of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Polar surface area (PSA) of (4-methoxyphenyl)-dimethyl-prop-2-enylsilane is 9.23000. |
| Q: What is the safety information for (4-methoxyphenyl)-dimethyl-prop-2-enylsilane? |
| A: Safety information for (4-methoxyphenyl)-dimethyl-prop-2-enylsilane: 26-36. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |