allyl(4-methoxyphenyl)dimethylsilane structure
|
Common Name | allyl(4-methoxyphenyl)dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 68469-60-3 | Molecular Weight | 206.35600 | |
| Density | 0.935 g/mL at 25ºC(lit.) | Boiling Point | 253ºC(lit.) | |
| Molecular Formula | C12H18OSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 215 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-methoxyphenyl)-dimethyl-prop-2-enylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.935 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 253ºC(lit.) |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.35600 |
| Flash Point | 215 °F |
| Exact Mass | 206.11300 |
| PSA | 9.23000 |
| LogP | 2.79660 |
| Index of Refraction | n20/D 1.519(lit.) |
| InChIKey | BEKRXBQZYQZFBV-UHFFFAOYSA-N |
| SMILES | C=CC[Si](C)(C)c1ccc(OC)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
allyl(4-methoxy... CAS#:68469-60-3 |
| Literature: Journal of the American Chemical Society, , vol. 100, p. 5534 - 5540 |
|
~%
allyl(4-methoxy... CAS#:68469-60-3 |
| Literature: Journal of Organic Chemistry, , vol. 62, # 18 p. 6102 - 6103 |
| MFCD01862880 |
| Allyl(4-methoxyphenyl)dimethylsilane |
| Allyldimethyl(4-methoxyphenyl)silane |