4-oxo Withaferin A structure
|
Common Name | 4-oxo Withaferin A | ||
|---|---|---|---|---|
| CAS Number | 6850-30-2 | Molecular Weight | 468.58200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H36O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-oxo Withaferin A4-Dehydrowithaferin A is the analogue of withaferin A. Withaferin A is a withanolide isolated from Withania somnifera. 4-Dehydrowithaferin A has the potential for the research of multiple myeloma[1]. |
| Name | 4-dehydro-withaferin A |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Dehydrowithaferin A is the analogue of withaferin A. Withaferin A is a withanolide isolated from Withania somnifera. 4-Dehydrowithaferin A has the potential for the research of multiple myeloma[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H36O6 |
|---|---|
| Molecular Weight | 468.58200 |
| Exact Mass | 468.25100 |
| PSA | 93.20000 |
| LogP | 3.56110 |
| InChIKey | XGPALHIQWWGRFB-TTWUVOALSA-N |
| SMILES | CC1=C(CO)C(=O)OC(C(C)C2CCC3C4CC5OC56C(=O)C=CC(=O)C6(C)C4CCC23C)C1 |
| 4-dehydrowithaferin A |
| 4-DEHYDROWITHAFERIN A |