WAY-323972 structure
|
Common Name | WAY-323972 | ||
|---|---|---|---|---|
| CAS Number | 685135-21-1 | Molecular Weight | 350.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-323972inhibitor of the interaction of MDM4 and p53 |
| Name | WAY-323972 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClN2O5 |
|---|---|
| Molecular Weight | 350.75 |
| InChIKey | JIDPPVRVNVTURA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2C(=O)C(Cl)=C(N3CCOCC3)C2=O)cc1 |
| Benzoic acid, 4-[3-chloro-2,5-dihydro-4-(4-morpholinyl)-2,5-dioxo-1H-pyrrol-1-yl]-, methyl ester |