trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane
trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane structure
|
Common Name | trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 686-95-3 | Molecular Weight | 296.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12F3ISi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H12F3ISi |
|---|---|
| Molecular Weight | 296.14500 |
| Exact Mass | 295.97100 |
| LogP | 4.03970 |
| InChIKey | QXORCDMRAUXYFF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(I)CC(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
trimethyl-(3,3,... CAS#:686-95-3 |
| Literature: Fuchikami, Takamasa; Ojima, Iwao Tetrahedron Letters, 1984 , vol. 25, # 3 p. 303 - 306 |
|
~%
trimethyl-(3,3,... CAS#:686-95-3 |
| Literature: Geyer et al. Journal of the Chemical Society, 1957 , p. 4472,4479 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: InChIKey of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is QXORCDMRAUXYFF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: SMILES notation of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is C[Si](C)(C)C(I)CC(F)(F)F. |
| Q: What is the English name of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: The English name of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane. |
| Q: What is the molecular weight of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: Molecular weight of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is 296.14500. |
| Q: What is the Chinese name of 686-95-3? |
| A: Chinese name of 686-95-3 is 686-95-3. |
| Q: What is the CAS number of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: CAS number of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is 686-95-3. |
| Q: What is the molecular formula of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: Molecular formula of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is C6H12F3ISi. |
| Q: What is the LogP of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: LogP of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane is 4.03970. |
| Q: What are the upstream materials of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane? |
| A: Related upstream materials(CAS) of trimethyl-(3,3,3-trifluoro-1-iodopropyl)silane: 2314-97-8;754-05-2. |