N,N,N',N'-Tetraethylbenzidine structure
|
Common Name | N,N,N',N'-Tetraethylbenzidine | ||
|---|---|---|---|---|
| CAS Number | 6860-63-5 | Molecular Weight | 296.45000 | |
| Density | 0.999g/cm3 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C20H28N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 4-[4-(diethylamino)phenyl]-N,N-diethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.45000 |
| Flash Point | 197.4ºC |
| Exact Mass | 296.22500 |
| PSA | 6.48000 |
| LogP | 5.04600 |
| Index of Refraction | 1.574 |
| InChIKey | BDZHBJPMMZFUJV-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(-c2ccc(N(CC)CC)cc2)cc1 |
| HS Code | 2921590090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N,N',N'-tetraethylbiphenyl-4,4'-diamine |
| tetra-N-ethyl-benzidine |
| Benzidine,N,N,N',N'-tetraethyl |
| N,N,N',N'-tetraethylbenzidine |
| Tetra-N-aethyl-benzidin |