Poly(dicyclopentadiene-co-p-cresol)
Modify Date: 2025-08-27 18:48:31
Poly(dicyclopentadiene-co-p-cresol) structure
|
Common Name | Poly(dicyclopentadiene-co-p-cresol) | ||
|---|---|---|---|---|
| CAS Number | 68610-51-5 | Molecular Weight | 258.398 | |
| Density | 1.04 g/cm3 | Boiling Point | 170ºC at 760 mmHg | |
| Molecular Formula | C21H28O | Melting Point | 105ºC | |
| MSDS | Chinese USA | Flash Point | 46.8ºC | |
| Name | Polymeric sterically hindered phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04 g/cm3 |
|---|---|
| Boiling Point | 170ºC at 760 mmHg |
| Melting Point | 105ºC |
| Molecular Formula | C21H28O |
| Molecular Weight | 258.398 |
| Flash Point | 46.8ºC |
| Exact Mass | 258.198364 |
| PSA | 20.23000 |
| LogP | 5.66760 |
| InChIKey | UQQYHXZNSYZMEN-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=C(C)C.Cc1ccc(O)cc1 |
| Hazard Statements | H413 |
|---|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| EINECS 271-867-2 |
| MFCD00804502 |
| Phenol, 4-methyl-, compd. with octahydro-4,7-ethano-1H-indene (1:1) |
| Poly(dicyclopentadiene-co-p-cresol) |
| 4-Methylphenol - tricyclo[5.2.2.0]undecane (1:1) |