Polyquaternium-10 structure
|
Common Name | Polyquaternium-10 | ||
|---|---|---|---|---|
| CAS Number | 68610-92-4 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | (C2H4O)n.C6H16NO2.xCl.xUnspecified | Melting Point | 290 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Polyquaternium-10 |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 290 °C(lit.) |
|---|---|
| Molecular Formula | (C2H4O)n.C6H16NO2.xCl.xUnspecified |
| InChIKey | FQOVCYRTDMQFLY-QZUVRZIUSA-M |
| SMILES | C[N+](C)(C)CC(O)COCCOC1C(O)OC(COCO)C(OC2OC(CO)C(OCCO)C(OCCO)C2O)C1O.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Cellulose 2-(2-hydroxy-3-(trimethylammonio)propoxy) ethyl ether chloride |
| MFCD01771473 |
| Cellulose ether with a-[2-hydroxy-3-(trimethylammonio)propyl]-w-hydroxypoly(oxy-1,2-ethanediyl) chloride |