4-benzyloxyphenylacetic acid methyl ester structure
|
Common Name | 4-benzyloxyphenylacetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 68641-16-7 | Molecular Weight | 256.29600 | |
| Density | 1.129g/cm3 | Boiling Point | 375ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | 53ºC | |
| MSDS | N/A | Flash Point | 157.3ºC | |
| Name | methyl 2-(4-phenylmethoxyphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 375ºC at 760 mmHg |
| Melting Point | 53ºC |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 157.3ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 2.98110 |
| Index of Refraction | 1.559 |
| InChIKey | OUWFDISHMBDYON-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc(OCc2ccccc2)cc1 |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00157061 |
| methyl 2-[4-(benzyloxy)benzyl]acetate |
| 4-Benzyloxyphenylacetic acid methyl ester |
| methyl 2-(4-(benzyloxy)phenyl)acetate |
| Methyl 4-benzyloxyphenylacetate |
| Methyl <p-(Benzyloxy)phenyl>acetate |