WAY-327136
Modify Date: 2024-04-03 11:18:26
WAY-327136 structure
|
Common Name | WAY-327136 | ||
|---|---|---|---|---|
| CAS Number | 686725-20-2 | Molecular Weight | 444.45 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 569.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H23F3N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.3±32.9 °C | |
Use of WAY-327136modulators of advanced glycosylation end product receptor (RAGE) activity |
| Name | WAY-327136 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 569.7±60.0 °C at 760 mmHg |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.45 |
| Flash Point | 298.3±32.9 °C |
| Exact Mass | 444.177307 |
| LogP | 5.23 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | VAACNUHBNNORND-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1cc(C(F)(F)F)nc(N2CCN(c3ccccc3OC)CC2)n1 |
| Pyrimidine, 4-(2-methoxyphenyl)-2-[4-(2-methoxyphenyl)-1-piperazinyl]-6-(trifluoromethyl)- |
| 4-(2-Methoxyphenyl)-2-[4-(2-methoxyphenyl)-1-piperazinyl]-6-(trifluoromethyl)pyrimidine |