6-(Trifluoromethyl)-1-indanone structure
|
Common Name | 6-(Trifluoromethyl)-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 68755-37-3 | Molecular Weight | 200.15700 | |
| Density | 1.321 | Boiling Point | 76-78ºC (0.2 MMHG) | |
| Molecular Formula | C10H7F3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 6-(Trifluoromethyl)-1-indanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321 |
|---|---|
| Boiling Point | 76-78ºC (0.2 MMHG) |
| Molecular Formula | C10H7F3O |
| Molecular Weight | 200.15700 |
| Flash Point | 110ºC |
| Exact Mass | 200.04500 |
| PSA | 17.07000 |
| LogP | 2.83430 |
| Index of Refraction | 1.496 |
| InChIKey | IGDFHUWAXWFKMW-UHFFFAOYSA-N |
| SMILES | O=C1CCc2ccc(C(F)(F)F)cc21 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H334 |
| Precautionary Statements | P261-P342 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | R22;R43 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
|
~52%
6-(Trifluoromet... CAS#:68755-37-3 |
| Literature: US2005/261310 A1, ; Page/Page column 22 ; US 20050261310 A1 |
|
~23%
6-(Trifluoromet... CAS#:68755-37-3 |
| Literature: Tetrahedron, , vol. 63, # 2 p. 389 - 395 |
|
~%
6-(Trifluoromet... CAS#:68755-37-3 |
| Literature: Tetrahedron, , vol. 63, # 2 p. 389 - 395 |
|
~%
6-(Trifluoromet... CAS#:68755-37-3 |
| Literature: Tetrahedron, , vol. 63, # 2 p. 389 - 395 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-(trifluoromethyl)-2,3-dihydroinden-1-one |