p-(tert-butyl)[(2-hydroxy-1-naphthyl)methylene]benzohydrazide structure
|
Common Name | p-(tert-butyl)[(2-hydroxy-1-naphthyl)methylene]benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 68758-85-0 | Molecular Weight | 346.42200 | |
| Density | 1.207g/cm3 | Boiling Point | 515.2ºC at 760 mmHg | |
| Molecular Formula | C22H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.4ºC | |
| Name | 4-tert-butyl-N'-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 515.2ºC at 760 mmHg |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.42200 |
| Flash Point | 166.4ºC |
| Exact Mass | 346.16800 |
| PSA | 58.20000 |
| LogP | 4.63730 |
| Index of Refraction | 1.646 |
| InChIKey | QSEQSUVWYBZMLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)NN=Cc2c(O)ccc3ccccc23)cc1 |
|
~%
p-(tert-butyl)[... CAS#:68758-85-0 |
| Literature: Edward, John T.; Gauthier, Mario; Chubb, Francis L.; Ponka, Premysl Journal of Chemical & Engineering Data, 1988 , vol. 33, # 4 p. 538 - 540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 272-160-1 |
| 2-OH-1-Naphth-CHO,hydrazone deriv. |
| BBNH |