WAY-328268 structure
|
Common Name | WAY-328268 | ||
|---|---|---|---|---|
| CAS Number | 688050-53-5 | Molecular Weight | 326.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-328268modulating CFTR activity; altering the lifespan of a eukaryotic organism; anti-restenosis activity and accelerates reendothelization; activator of Wnt/b-catenin signal transmission; |
| Name | WAY-328268 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18N4O3 |
|---|---|
| Molecular Weight | 326.35 |
| InChIKey | YUZSRIYULTYUIB-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cc(C(=O)NCCCn3ccnc3)no2)c1 |
| 3-Isoxazolecarboxamide, N-[3-(1H-imidazol-1-yl)propyl]-5-(3-methoxyphenyl)- |