1-bromo-4-(tetrafluoroethoxy)benzene structure
|
Common Name | 1-bromo-4-(tetrafluoroethoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 68834-05-9 | Molecular Weight | 273.02200 | |
| Density | 1.628 g/mL at 25 °C(lit.) | Boiling Point | 195-196 °C(lit.) | |
| Molecular Formula | C8H5BrF4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190 °F | |
| Name | 1-Bromo-4-(1,1,2,2-tetrafluoroethoxy)-benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.628 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 195-196 °C(lit.) |
| Molecular Formula | C8H5BrF4O |
| Molecular Weight | 273.02200 |
| Flash Point | 190 °F |
| Exact Mass | 271.94600 |
| PSA | 9.23000 |
| LogP | 3.68580 |
| Index of Refraction | n20/D 1.4600(lit.) |
| InChIKey | VKJYIOCMIHTAET-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)Oc1ccc(Br)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 272-431-4 |
| MFCD00042190 |
| 1-bromo-4-(1,1,2,2-tetrafluoroethoxy)benzene |