Aflatoxin M2
Modify Date: 2025-08-20 17:54:12
Aflatoxin M2 structure
|
Common Name | Aflatoxin M2 | ||
|---|---|---|---|---|
| CAS Number | 6885-57-0 | Molecular Weight | 330.28900 | |
| Density | 1.62g/cm3 | Boiling Point | 635.6ºC at 760 mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | 181-184ºC | |
| MSDS | N/A | Flash Point | 6ºC | |
Use of Aflatoxin M2Aflatoxin M2 is a major metabolite of Aflatoxin B1. Aflatoxin M2 is a mycotoxin produced by the fungi Aspergillus flavus and Aspergillus parasiticus. The level of toxicity associated with Aflatoxin is Aflatoxin B1>Aflatoxin M1>Aflatoxin G1>Aflatoxin B2>Aflatoxin M2>Aflatoxin G2[1]. |
| Name | aflatoxin m2 |
|---|---|
| Synonym | More Synonyms |
| Description | Aflatoxin M2 is a major metabolite of Aflatoxin B1. Aflatoxin M2 is a mycotoxin produced by the fungi Aspergillus flavus and Aspergillus parasiticus. The level of toxicity associated with Aflatoxin is Aflatoxin B1>Aflatoxin M1>Aflatoxin G1>Aflatoxin B2>Aflatoxin M2>Aflatoxin G2[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 635.6ºC at 760 mmHg |
| Melting Point | 181-184ºC |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.28900 |
| Flash Point | 6ºC |
| Exact Mass | 330.07400 |
| PSA | 95.20000 |
| LogP | 1.25690 |
| Index of Refraction | 1.689 |
| InChIKey | OQLKWHFMUPJCJY-ZYMOGRSISA-N |
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)CCC4=O)C1(O)CCOC1O2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T,T+,Xn,F |
|---|---|
| Risk Phrases | 45-46-26/27/28-36-20/21/22-11 |
| Safety Phrases | 53-22-36/37/39-45-36-26-16 |
| RIDADR | UN 3172 |
| Hazard Class | 6.1(a) |
| 4-Hydroxyaflatoxin B2 |
| Cyclopenta(c)furo(3',2':4,5)furo(2,3-h)(1)benzopyran-1,11-dione,2,3,6a,8,9,9a-hexahydro-9a-hydroxy-4-methoxy |
| Aflatoxin M(2) |
| 2,3,6a,8,9,9a-hexahydro-9a-hydroxy-4-methoxycyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-1,11-dione |