4-(2-FLUORO-4-AMINOPHENOXY)-7-AZAINDOLE structure
|
Common Name | 4-(2-FLUORO-4-AMINOPHENOXY)-7-AZAINDOLE | ||
|---|---|---|---|---|
| CAS Number | 688781-75-1 | Molecular Weight | 243.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline, also known as 4-(2-fluoro-4-aminophenoxy)-7-azaindole, has a CAS number of 688781-75-1. Its molecular formula is C13H10FN3O and molecular weight is 243.24. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10FN3O |
|---|---|
| Molecular Weight | 243.23600 |
| Exact Mass | 243.08100 |
| PSA | 63.93000 |
| LogP | 3.65770 |
| InChIKey | HQYDVMOYLQJCFB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccnc3[nH]ccc23)c(F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: Related upstream materials(CAS) of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline: 888720-59-0;688781-89-7;881902-82-5;688781-87-5;881902-80-3;869335-22-8;881902-81-4;399-96-2;74420-03-4;74420-06-7. |
| Q: What are the downstream products of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: Related downstream products(CAS) of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline: 888719-03-7. |
| Q: What is the Chinese name of 688781-75-1? |
| A: Chinese name of 688781-75-1 is 688781-75-1. |
| Q: What is the SMILES notation of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: SMILES notation of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is Nc1ccc(Oc2ccnc3[nH]ccc23)c(F)c1. |
| Q: What is the CAS number of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: CAS number of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is 688781-75-1. |
| Q: What is the InChIKey of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: InChIKey of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is HQYDVMOYLQJCFB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: Molecular formula of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is C13H10FN3O. |
| Q: What is the English name of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: The English name of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline. |
| Q: What is the LogP of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: LogP of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is 3.65770. |
| Q: What is the polar surface area (PSA) of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline? |
| A: Polar surface area (PSA) of 3-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)aniline is 63.93000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |