6-Chlor-4-nitro-1H-pyrrolo[2,3-b]pyridin structure
|
Common Name | 6-Chlor-4-nitro-1H-pyrrolo[2,3-b]pyridin | ||
|---|---|---|---|---|
| CAS Number | 688781-87-5 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 393.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6±26.5 °C | |
| Name | 6-chloro-4-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.3±37.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 191.6±26.5 °C |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | OOHNIAVMKNEEGR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)nc2[nH]ccc12 |
| HS Code | 2933990090 |
|---|
|
~68%
6-Chlor-4-nitro... CAS#:688781-87-5 |
| Literature: BAYER HEALTHCARE AG Patent: WO2005/108397 A1, 2005 ; Location in patent: Page/Page column 28-29 ; |
|
~%
6-Chlor-4-nitro... CAS#:688781-87-5 |
| Literature: Bayer HealthCare AG Patent: US2008/269268 A1, 2008 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-PYRROLO[2,3-B]PYRIDINE,6-CHLORO-4-NITRO |
| 6-Chlor-4-nitro-1H-pyrrolo[2,3-b]pyridin |
| 4-Nitro-6-chloro-7-azaindole |