2-(3-nitrophenyl)-2-oxo-acetaldehyde
Modify Date: 2025-08-25 13:00:43
2-(3-nitrophenyl)-2-oxo-acetaldehyde structure
|
Common Name | 2-(3-nitrophenyl)-2-oxo-acetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 6890-77-3 | Molecular Weight | 179.13000 | |
| Density | 1.376g/cm3 | Boiling Point | 300ºC at 760 mmHg | |
| Molecular Formula | C8H5NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.1ºC | |
| Name | 2-(3-nitrophenyl)-2-oxoacetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 300ºC at 760 mmHg |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13000 |
| Flash Point | 147.1ºC |
| Exact Mass | 179.02200 |
| PSA | 79.96000 |
| LogP | 1.49960 |
| Index of Refraction | 1.575 |
| InChIKey | PPDGMLLCCLUIKZ-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2914400090 |
|---|
|
~%
2-(3-nitropheny... CAS#:6890-77-3 |
| Literature: Mushran, S. P.; Pandey, Lalji; Kameshwar, Singh Monatshefte fuer Chemie, 1980 , vol. 111, # 5 p. 1135 - 1142 |
|
~%
2-(3-nitropheny... CAS#:6890-77-3 |
| Literature: Evans; Witzemann Journal of the American Chemical Society, 1911 , vol. 33, p. 1773 |
|
~%
2-(3-nitropheny... CAS#:6890-77-3 |
| Literature: Evans; Witzemann Journal of the American Chemical Society, 1911 , vol. 33, p. 1773 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (3-Nitro-phenyl)-oxo-acetaldehyde |
| 2-(3-nitrophenyl)-2-oxo-acetaldehyde |
| m-nitrophenylglyoxal |
| m-nitrophenylglyoxal monhydrate |
| 3-Nitro-benzoylformaldehyd |
| (3-Nitro-phenyl)-glyoxal |
| 2-oxo-2-(3-nitrophenyl)acetaldehyde |