Copper(II) acetate structure
|
Common Name | Copper(II) acetate | ||
|---|---|---|---|---|
| CAS Number | 142-71-2 | Molecular Weight | 123.59800 | |
| Density | 1.068g/cm3 | Boiling Point | 117.1ºC at 760 mmHg | |
| Molecular Formula | C2H4CuO2++ | Melting Point | 115ºC | |
| MSDS | Chinese USA | Flash Point | 40ºC | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | copper acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 117.1ºC at 760 mmHg |
| Melting Point | 115ºC |
| Molecular Formula | C2H4CuO2++ |
| Molecular Weight | 123.59800 |
| Flash Point | 40ºC |
| Exact Mass | 122.95100 |
| PSA | 37.30000 |
| LogP | 0.08840 |
| Vapour density | 6.9 (vs air) |
| InChIKey | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314-H410 |
| Precautionary Statements | P260-P280-P301 + P312 + P330-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R36/37/38;R50/53 |
| Safety Phrases | S26-S60-S61 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | AG3480000 |
| Hazard Class | 9.0 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
|
Continuous syntheses of Pd@Pt and Cu@Ag core-shell nanoparticles using microwave-assisted core particle formation coupled with galvanic metal displacement.
Nanoscale 6(15) , 8720-5, (2014) Continuous synthesis of Pd@Pt and Cu@Ag core-shell nanoparticles was performed using flow processes including microwave-assisted Pd (or Cu) core-nanoparticle formation followed by galvanic displacemen... |
|
|
Hybrid nanostructured C-dot decorated Fe3O4 electrode materials for superior electrochemical energy storage performance.
Dalton Trans. 44 , 9221-9, (2015) Research on energy storage devices has created a niche owing to the ever increasing demand for alternative energy production and its efficient utilisation. Here, a novel composite of Fe3O4 nanospheres... |
|
|
Spherulitic copper-copper oxide nanostructure-based highly sensitive nonenzymatic glucose sensor.
Int. J. Nanomedicine 10 Spec Iss , 165-78, (2015) In this work, three different spherulitic nanostructures Cu-CuOA, Cu-CuOB, and Cu-CuOC were synthesized in water-in-oil microemulsions by varying the surfactant concentration (30 mM, 40 mM, and 50 mM,... |
| acetic acid copper(2+) salt (2:1) |
| copper,diacetate |
| MFCD00008690 |
| copper(2+) acetate |
| EINECS 205-553-3 |
| copper(II) acetate |
| cupric acetate |
| Copper(II)acetate |