5-nitro-2-phenylpyrimidine structure
|
Common Name | 5-nitro-2-phenylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 68906-00-3 | Molecular Weight | 201.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-2-phenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7N3O2 |
|---|---|
| Molecular Weight | 201.18100 |
| Exact Mass | 201.05400 |
| PSA | 71.60000 |
| LogP | 2.57500 |
| InChIKey | GXRWVLAMQREVBB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(-c2ccccc2)nc1 |
|
~86%
5-nitro-2-pheny... CAS#:68906-00-3 |
| Literature: Barczynski, P.; Plas, H. C. van der Journal of Organic Chemistry, 1982 , vol. 47, # 6 p. 1077 - 1080 |
|
~%
5-nitro-2-pheny... CAS#:68906-00-3 |
| Literature: Hale; Brill Journal of the American Chemical Society, 1912 , vol. 34, p. 91 |
|
~%
5-nitro-2-pheny... CAS#:68906-00-3 |
| Literature: Fanta; Hedman Journal of the American Chemical Society, 1956 , vol. 78, p. 1434,1435 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 2-phenyl-5-nitropyrimidine |
| 5-Nitro-2-phenyl-pyrimidin |
| 5-nitro-2-phenyl-pyrimidine |
| Pyrimidine,5-nitro-2-phenyl |