Carbamicacid, (4-nitrophenyl)-, (4-methoxyphenyl)methyl ester (9CI)
Modify Date: 2025-09-05 17:05:01
Carbamicacid, (4-nitrophenyl)-, (4-methoxyphenyl)methyl ester (9CI) structure
|
Common Name | Carbamicacid, (4-nitrophenyl)-, (4-methoxyphenyl)methyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 68931-74-8 | Molecular Weight | 302.28200 | |
| Density | 1.34g/cm3 | Boiling Point | 438.9ºC at 760mmHg | |
| Molecular Formula | C15H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | (4-methoxyphenyl)methyl N-(4-nitrophenyl)carbamate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 438.9ºC at 760mmHg |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.28200 |
| Flash Point | 219.3ºC |
| Exact Mass | 302.09000 |
| PSA | 93.38000 |
| LogP | 3.94830 |
| Index of Refraction | 1.627 |
| InChIKey | BIYJEAJHXTYXBN-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Carbamicacid, (... CAS#:68931-74-8 |
| Literature: Verrinder,D.J. et al. Canadian Journal of Chemistry, 1978 , vol. 56, p. 2582 - 2589 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |