7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one
7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one structure
|
Common Name | 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 68939-22-0 | Molecular Weight | 298.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 7-Hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one (Chinese name: 7-羟基-5-甲氧基-3-(4-甲氧基苯基)色原酮, CAS number: 68939-22-0, molecular formula: C17H14O5, molecular weight: 298.29000), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O5 |
|---|---|
| Molecular Weight | 298.29000 |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |
| InChIKey | JQQULYXWXRNRAX-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2coc3cc(O)cc(OC)c3c2=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
CAS#:104-47-2
CAS#:2174-64-3
CAS#:109-94-4
CAS#:491-80-5
CAS#:15485-66-2
CAS#:108-73-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-hydroxy-4',5-dimethoxy-isoflavone |
| 7-hydroxy-5,4'-dimethoxyisoflavone |
| 5-O-Methylbiochanin A |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: Polar surface area (PSA) of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is 68.90000. |
| Q: What is the LogP of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: LogP of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is 3.18280. |
| Q: What is the molecular weight of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: Molecular weight of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is 298.29000. |
| Q: What English synonyms does 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one have? |
| A: English synonyms of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one: 7-hydroxy-4',5-dimethoxy-isoflavone, 7-hydroxy-5,4'-dimethoxyisoflavone, 5-O-Methylbiochanin A. |
| Q: What is the CAS number of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: CAS number of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is 68939-22-0. |
| Q: What is the English name of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: The English name of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one. |
| Q: What is the SMILES notation of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: SMILES notation of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is COc1ccc(-c2coc3cc(O)cc(OC)c3c2=O)cc1. |
| Q: What is the molecular formula of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: Molecular formula of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is C17H14O5. |
| Q: What is the Chinese name of 68939-22-0? |
| A: Chinese name of 68939-22-0 is 68939-22-0. |
| Q: What is the InChIKey of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one? |
| A: InChIKey of 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one is JQQULYXWXRNRAX-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |