Aluminum,bis(2-butanolato)(triethyl orthosilicato-kO''')-
Modify Date: 2025-08-26 06:06:21
Aluminum,bis(2-butanolato)(triethyl orthosilicato-kO''')- structure
|
Common Name | Aluminum,bis(2-butanolato)(triethyl orthosilicato-kO''')- | ||
|---|---|---|---|---|
| CAS Number | 68959-06-8 | Molecular Weight | 352.47500 | |
| Density | 1 | Boiling Point | >200ºC | |
| Molecular Formula | C14H33AlO6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 45ºC | |
| Name | Di-Sec-Butoxyaluminoxytriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1 |
|---|---|
| Boiling Point | >200ºC |
| Molecular Formula | C14H33AlO6Si |
| Molecular Weight | 352.47500 |
| Flash Point | 45ºC |
| Exact Mass | 352.18600 |
| PSA | 55.38000 |
| LogP | 3.54400 |
| Index of Refraction | 1.42225 |
| InChIKey | MTHHTRVJDXYJHE-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)O[Al](OC(C)CC)OC(C)CC |
| Water Solubility | Hydrolyzes with water. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R10 |
| Safety Phrases | 16-36/37/39 |
| RIDADR | UN 1993 |
| Packaging Group | II |
| MFCD00053771 |
| di(butan-2-yloxy)alumanyl triethyl silicate |
| EINECS 273-392-6 |