Mulberrofuran A structure
|
Common Name | Mulberrofuran A | ||
|---|---|---|---|---|
| CAS Number | 68978-04-1 | Molecular Weight | 392.48700 | |
| Density | 1.14g/cm3 | Boiling Point | 506.6ºC at 760 mmHg | |
| Molecular Formula | C25H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.2ºC | |
Use of Mulberrofuran AMulberrofuran A is a natural product, that can be isolated from the root bark of mulberry tree. Mulberrofuran A inhibits the formations of 12-hydroxy-,8,10-heptadecatrienoic acid (HHT) and thromboxane B2 (cyclooxygenase products), but it increases the formation of 12-hydroxy-5,8,10,14-eicosatetraenoic acid (12-HETE) (12-lipoxygenase product)[1]. |
| Name | 2-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-3-methoxyphenyl]-1-benzofuran-6-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Mulberrofuran A is a natural product, that can be isolated from the root bark of mulberry tree. Mulberrofuran A inhibits the formations of 12-hydroxy-,8,10-heptadecatrienoic acid (HHT) and thromboxane B2 (cyclooxygenase products), but it increases the formation of 12-hydroxy-5,8,10,14-eicosatetraenoic acid (12-HETE) (12-lipoxygenase product)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 506.6ºC at 760 mmHg |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.48700 |
| Flash Point | 260.2ºC |
| Exact Mass | 392.19900 |
| PSA | 62.83000 |
| LogP | 6.75480 |
| Index of Refraction | 1.6 |
| InChIKey | MQYYTNPXQXSQGM-CAOOACKPSA-N |
| SMILES | COc1cc(O)cc(-c2cc3ccc(O)cc3o2)c1CC=C(C)CCC=C(C)C |
| Water Solubility | Insuluble (2.9E-4 g/L) (25 ºC) |
| Mulberrofuran A |