2-bromo-5-hydroxynaphthalene-1,4-dione structure
|
Common Name | 2-bromo-5-hydroxynaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 69008-03-3 | Molecular Weight | 253.04900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5-hydroxynaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H5BrO3 |
|---|---|
| Molecular Weight | 253.04900 |
| Exact Mass | 251.94200 |
| PSA | 54.37000 |
| LogP | 2.05000 |
| InChIKey | RGSIRCRADOOHTL-UHFFFAOYSA-N |
| SMILES | O=C1C(Br)=CC(=O)c2c(O)cccc21 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-bromo-8-hydroxy-1,4-naphthaquinone |
| 2-Bromojuglone |
| 1,4-Naphthalenedione,2-bromo-5-hydroxy |