Germacrone structure
|
Common Name | Germacrone | ||
|---|---|---|---|---|
| CAS Number | 6902-91-6 | Molecular Weight | 218.335 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 330.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O | Melting Point | 55-58ºC | |
| MSDS | N/A | Flash Point | 148.4±18.7 °C | |
Use of GermacroneGermacrone is extracted from Rhizoma Curcuma. Germacrone inhibits influenza virus infection[1]. |
| Name | (3E,7E)-3,7-Dimethyl-10-(propan-2-ylidene)cyclodeca-3,7-dienone |
|---|---|
| Synonym | More Synonyms |
| Description | Germacrone is extracted from Rhizoma Curcuma. Germacrone inhibits influenza virus infection[1]. |
|---|---|
| Related Catalog | |
| Target |
Influenza virus[1] |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.3±42.0 °C at 760 mmHg |
| Melting Point | 55-58ºC |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.335 |
| Flash Point | 148.4±18.7 °C |
| Exact Mass | 218.167068 |
| PSA | 17.07000 |
| LogP | 4.76 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | CAULGCQHVOVVRN-CZAVNJROSA-N |
| SMILES | CC1=CCC(=C(C)C)C(=O)CC(C)=CCC1 |
| Storage condition | 2-8°C |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| (3E,7E)-10-Isopropylidene-3,7-dimethyl-3,7-cyclodecadien-1-one |
| 3,7-Cyclodecadien-1-one, 3,7-dimethyl-10-(1-methylethylidene)-, (E,E)- |
| (7E)-3,7-dimethyl-10-(propan-2-ylidene)cyclodeca-3,7-dien-1-one |
| 3,7-Cyclodecadien-1-one, 3,7-dimethyl-10-(1-methylethylidene)-, (3E,7E)- |
| (3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-one |
| (3E,7E)-10-Isopropylidene-3,7-dimethylcyclodeca-3,7-dien-1-one |
| 3,7-Cyclodecadien-1-one, 3,7-dimethyl-10-(1-methylethylidene)-, (3Z,7Z)- |
| (3E,7E)-3,7-dimethyl-10-(propan-2-ylidene)cyclodeca-3,7-dien-1-one |
| (3Z,7Z)-10-Isopropylidene-3,7-dimethyl-3,7-cyclodecadien-1-one |
| Germacrone |