3-(Benzyloxy)benzoic acid structure
|
Common Name | 3-(Benzyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 69026-14-8 | Molecular Weight | 228.243 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 408.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | 133-137ºC | |
| MSDS | Chinese USA | Flash Point | 157.9±15.3 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 3-phenylmethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.8±20.0 °C at 760 mmHg |
| Melting Point | 133-137ºC |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.243 |
| Flash Point | 157.9±15.3 °C |
| Exact Mass | 228.078644 |
| PSA | 46.53000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | CISXCTKEQYOZAM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(OCc2ccccc2)c1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,N |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(Benzyloxy)benzoic acid |
| m-Benzyloxybenzoic acid |
| 3-benzyloxybenzoic acid |
| Benzoic acid, 3-(phenylmethoxy)- |