Grifolin【terpenoid】 structure
|
Common Name | Grifolin【terpenoid】 | ||
|---|---|---|---|---|
| CAS Number | 6903-07-7 | Molecular Weight | 328.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Grifolin【terpenoid】Grifolin is an antineoplastic agent can be isolated from the mushroom Albatrellus confluens and significantly induces apoptosis[1]. |
| Name | grifolin |
|---|---|
| Synonym | More Synonyms |
| Description | Grifolin is an antineoplastic agent can be isolated from the mushroom Albatrellus confluens and significantly induces apoptosis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H32O2 |
|---|---|
| Molecular Weight | 328.49 |
| Exact Mass | 328.24000 |
| PSA | 40.46000 |
| LogP | 6.36790 |
| InChIKey | PZHNKNRPGLTZPO-VZRGJMDUSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)cc(C)cc1O |
| Grifolin |
| 5-methyl-2-(3,7,11-trimethyl-dodeca-2t,6t,10-trienyl)-resorcinol |
| 5-Methyl-2-(3,7,11-trimethyl-dodeca-2t,6t,10-trienyl)-resorcin |
| 5-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,3-diol |