N-Benzyl-2,3,4,5-tetrachloro-6-nitroaniline structure
|
Common Name | N-Benzyl-2,3,4,5-tetrachloro-6-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 69035-11-6 | Molecular Weight | 366.02700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Benzyl-2,3,4,5-tetrachloro-6-nitroaniline |
|---|
| Molecular Formula | C13H8Cl4N2O2 |
|---|---|
| Molecular Weight | 366.02700 |
| Exact Mass | 363.93400 |
| PSA | 57.85000 |
| LogP | 6.41670 |
| InChIKey | PCJJUQQEZXOJQX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1NCc1ccccc1 |
|
~%
N-Benzyl-2,3,4,... CAS#:69035-11-6 |
| Literature: Heaton,A.; Hunt,M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1204 - 1208 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |