N,N-DIETHYL-2,4-DINITRO-5-FLUOROANILINE*
N,N-DIETHYL-2,4-DINITRO-5-FLUOROANILINE* structure
|
Common Name | N,N-DIETHYL-2,4-DINITRO-5-FLUOROANILINE* | ||
|---|---|---|---|---|
| CAS Number | 6917-48-2 | Molecular Weight | 257.218 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 395.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H12FN3O4 | Melting Point | 116-118 °C | |
| MSDS | N/A | Flash Point | 192.8±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-diethyl-2,4-dinitro-5-fluoroaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.1±42.0 °C at 760 mmHg |
| Melting Point | 116-118 °C |
| Molecular Formula | C10H12FN3O4 |
| Molecular Weight | 257.218 |
| Flash Point | 192.8±27.9 °C |
| Exact Mass | 257.081177 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | VXGQQIQVKRTBFG-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | T |
|---|---|
| Risk Phrases | R23/24/25 |
| Safety Phrases | S36/37/39-45 |
| RIDADR | UN2811 6.1/PG 3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00043014 |
| EINECS 230-025-4 |
| N,N-diethyl-2,4-dinitro-5-fluoroaniline |
| N,N-Diethyl-5-fluoro-2,4-dinitroaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: LogP of N,N-diethyl-2,4-dinitro-5-fluoroaniline is 3.23. |
| Q: What is the melting point of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: Melting point of N,N-diethyl-2,4-dinitro-5-fluoroaniline is 116-118 °C. |
| Q: What is the English name of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: The English name of N,N-diethyl-2,4-dinitro-5-fluoroaniline is N,N-diethyl-2,4-dinitro-5-fluoroaniline. |
| Q: What is the InChIKey of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: InChIKey of N,N-diethyl-2,4-dinitro-5-fluoroaniline is VXGQQIQVKRTBFG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: SMILES notation of N,N-diethyl-2,4-dinitro-5-fluoroaniline is CCN(CC)c1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the CAS number of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: CAS number of N,N-diethyl-2,4-dinitro-5-fluoroaniline is 6917-48-2. |
| Q: What is the molecular formula of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: Molecular formula of N,N-diethyl-2,4-dinitro-5-fluoroaniline is C10H12FN3O4. |
| Q: What is the boiling point of N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: Boiling point of N,N-diethyl-2,4-dinitro-5-fluoroaniline is 395.1±42.0 °C at 760 mmHg. |
| Q: What is the safety information for N,N-diethyl-2,4-dinitro-5-fluoroaniline? |
| A: Safety information for N,N-diethyl-2,4-dinitro-5-fluoroaniline: S36/37/39-45. |
| Q: What English synonyms does N,N-diethyl-2,4-dinitro-5-fluoroaniline have? |
| A: English synonyms of N,N-diethyl-2,4-dinitro-5-fluoroaniline: MFCD00043014, EINECS 230-025-4, N,N-diethyl-2,4-dinitro-5-fluoroaniline, N,N-Diethyl-5-fluoro-2,4-dinitroaniline. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |