5-(((carboxymethyl)amino)methyl)uridine structure
|
Common Name | 5-(((carboxymethyl)amino)methyl)uridine | ||
|---|---|---|---|---|
| CAS Number | 69181-26-6 | Molecular Weight | 331.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-(((carboxymethyl)amino)methyl)uridine5-Carboxymethylaminomethyluridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
| Name | 5-(carboxymethylaminomethyl)uridine |
|---|
| Description | 5-Carboxymethylaminomethyluridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H17N3O8 |
|---|---|
| Molecular Weight | 331.28 |
| Exact Mass | 331.10200 |
| PSA | 174.11000 |
| InChIKey | VSCNRXVDHRNJOA-PNHWDRBUSA-N |
| SMILES | O=C(O)CNCc1cn(C2OC(CO)C(O)C2O)c(=O)[nH]c1=O |