Osthol hydrate structure
|
Common Name | Osthol hydrate | ||
|---|---|---|---|---|
| CAS Number | 69219-24-5 | Molecular Weight | 262.301 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5±22.2 °C | |
Use of Osthol hydrateOsthol hydrate is a natural product isolated from F. schottiana[1]. |
| Name | 8-(3-hydroxy-3-methylbutyl)-7-methoxy-2H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Osthol hydrate is a natural product isolated from F. schottiana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.7±45.0 °C at 760 mmHg |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.301 |
| Flash Point | 166.5±22.2 °C |
| Exact Mass | 262.120514 |
| PSA | 59.67000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | FYGJNTORCNKCGZ-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccc(=O)oc2c1CCC(C)(C)O |
| Hazard Codes | Xi |
|---|
| 2'-deoxymeranzin hydrate |
| 8-(3-Hydroxy-3-methylbutyl)-7-methoxy-2H-chromen-2-one |
| 2H-1-Benzopyran-2-one, 8-(3-hydroxy-3-methylbutyl)-7-methoxy- |