(2,5-Dimethoxyphenethyl)urea structure
|
Common Name | (2,5-Dimethoxyphenethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 69226-57-9 | Molecular Weight | 224.25600 | |
| Density | 1.141g/cm3 | Boiling Point | 376.3ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 2-(2,5-dimethoxyphenyl)ethylurea |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760 mmHg |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 181.4ºC |
| Exact Mass | 224.11600 |
| PSA | 74.57000 |
| LogP | 1.81930 |
| Index of Refraction | 1.533 |
| InChIKey | ZFLFMVQVVHIIFD-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(CCNC(N)=O)c1 |
|
~%
(2,5-Dimethoxyp... CAS#:69226-57-9 |
| Literature: Buck Journal of the American Chemical Society, 1934 , vol. 56, p. 1607 |