2,6-Dimethyl-D,L-tyrosine structure
|
Common Name | 2,6-Dimethyl-D,L-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 81806-45-3 | Molecular Weight | 209.242 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 412.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4±28.7 °C | |
| Name | 2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.8±45.0 °C at 760 mmHg |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.242 |
| Flash Point | 203.4±28.7 °C |
| Exact Mass | 209.105194 |
| PSA | 83.55000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | LSNDLIKCFHLFKO-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(N)C(=O)O |
| Storage condition | 2-8℃ |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-DIMETHOXYPHENETHYL ISOTHIOCYANATE |
| 2,6-Dimethyltyrosine |
| (s)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propionic acid |
| D,L-2',6'-dimethyltyrosine |
| 2-amino-3-(4-hydroxy-2,6-dimethyl-phenyl)-propionic acid |
| H-D,L-Dmt-OH |
| 2,6-Dimethyl-D,L-tyrosine |
| Tyrosine, 2,6-dimethyl- |