Obtucarbamate A structure
|
Common Name | Obtucarbamate A | ||
|---|---|---|---|---|
| CAS Number | 6935-99-5 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 271.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.0±27.3 °C | |
Use of Obtucarbamate AObtucarbamate A isolated from Disporum cantoniense has antitussive activity[1]. |
| Name | methyl N-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Obtucarbamate A isolated from Disporum cantoniense has antitussive activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.5±40.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 118.0±27.3 °C |
| Exact Mass | 238.095352 |
| PSA | 76.66000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | CNPWIVIIZHULCN-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1ccc(C)c(NC(=O)OC)c1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dimethyl 4-methyl-1,3-phenylenediurethane |
| dimethyl 2,4-toluenedicarbamate |
| Carbamic acid, N,N'-(4-methyl-1,3-phenylene)bis-, dimethyl ester |
| Dimethyl (4-methyl-1,3-phenylene)biscarbamate |
| 2,4-dimethoxy-carbonyl-aminotoluene |