(E)-1-(1H-indol-3-yl)-3-phenyl-prop-2-en-1-one structure
|
Common Name | (E)-1-(1H-indol-3-yl)-3-phenyl-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6937-38-8 | Molecular Weight | 247.29100 | |
| Density | 1.222g/cm3 | Boiling Point | 465.8ºC at 760 mmHg | |
| Molecular Formula | C17H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | (E)-1-(1H-indol-3-yl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 465.8ºC at 760 mmHg |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.29100 |
| Flash Point | 239.1ºC |
| Exact Mass | 247.10000 |
| PSA | 32.86000 |
| LogP | 4.06400 |
| Index of Refraction | 1.714 |
| InChIKey | KEZYTIZZNLLCGX-ZHACJKMWSA-N |
| SMILES | O=C(C=Cc1ccccc1)c1c[nH]c2ccccc12 |
|
~72%
(E)-1-(1H-indol... CAS#:6937-38-8 |
| Literature: Bajaj, Kiran; Szivastava; Lata; Chandra, Ramesh; Kumar, Ashok Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 7 p. 1723 - 1728 |
|
~69%
(E)-1-(1H-indol... CAS#:6937-38-8 |
| Literature: Guchhait, Sankar K.; Kashyap, Maneesh; Kamble, Harshad Journal of Organic Chemistry, 2011 , vol. 76, # 11 p. 4753 - 4758 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| hms2743a13 |